C35H42N4O8 — CID 130265962
[(E)-[1-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-(3-methylbutyl)-1-nitrocarbazol-3-yl]-1-oxopentan-2-ylidene]amino] acetate (PubChem CID 130265962) has the molecular formula C35H42N4O8 and a molecular weight of 646.74 g/mol. Its IUPAC name is [(E)-[1-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-(3-methylbutyl)-1-nitrocarbazol-3-yl]-1-oxopentan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-(3-methylbutyl)-1-nitrocarbazol-3-yl]-1-oxopentan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 130265962 |
| Molecular Formula | C35H42N4O8 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | [(E)-[1-[6-[(2E)-2-acetyloxyimino-3-cyclohexylpropanoyl]-9-(3-methylbutyl)-1-nitrocarbazol-3-yl]-1-oxopentan-2-ylidene]amino] acetate |
| SMILES | CCC/C(=N\OC(C)=O)C(=O)c1cc([N+](=O)[O-])c2c(c1)c1cc(C(=O)/C(CC3CCCCC3)=N/OC(C)=O)ccc1n2CCC(C)C |
| InChI | InChI=1S/C35H42N4O8/c1-6-10-29(36-46-22(4)40)35(43)26-19-28-27-18-25(34(42)30(37-47-23(5)41)17-24-11-8-7-9-12-24)13-14-31(27)38(16-15-21(2)3)33(28)32(20-26)39(44)45/h13-14,18-21,24H,6-12,15-17H2,1-5H3/b36-29+,37-30+ |
| InChIKey | UIGQTASTGDBWDA-CWUFWRKASA-N |
| XLogP | 7.72 |
| TPSA | 159.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|