C23H25N3O4 — CID 118902012
[(E)-[3-cyclobutyl-1-(9-ethyl-6-nitrocarbazol-3-yl)propylidene]amino] acetate (PubChem CID 118902012) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [(E)-[3-cyclobutyl-1-(9-ethyl-6-nitrocarbazol-3-yl)propylidene]amino] acetate.
| Compound Name | [(E)-[3-cyclobutyl-1-(9-ethyl-6-nitrocarbazol-3-yl)propylidene]amino] acetate |
|---|---|
| PubChem CID | 118902012 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(E)-[3-cyclobutyl-1-(9-ethyl-6-nitrocarbazol-3-yl)propylidene]amino] acetate |
| SMILES | CCn1c2ccc(/C(CCC3CCC3)=N/OC(C)=O)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H25N3O4/c1-3-25-22-11-8-17(21(24-30-15(2)27)10-7-16-5-4-6-16)13-19(22)20-14-18(26(28)29)9-12-23(20)25/h8-9,11-14,16H,3-7,10H2,1-2H3/b24-21+ |
| InChIKey | YVLKCWYXOZDCMS-DARPEHSRSA-N |
| XLogP | 5.57 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|