C33H36N2O3 — CID 172921191
[(Z)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-3-(3-methylcyclopentyl)propylidene]amino] acetate (PubChem CID 172921191) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(Z)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-3-(3-methylcyclopentyl)propylidene]amino] acetate.
| Compound Name | [(Z)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-3-(3-methylcyclopentyl)propylidene]amino] acetate |
|---|---|
| PubChem CID | 172921191 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(Z)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-3-(3-methylcyclopentyl)propylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(CCC3CCC(C)C3)=N\OC(C)=O)ccc21 |
| InChI | InChI=1S/C33H36N2O3/c1-5-35-31-16-13-25(30(34-38-23(4)36)15-12-24-11-10-21(2)18-24)19-28(31)29-20-26(14-17-32(29)35)33(37)27-9-7-6-8-22(27)3/h6-9,13-14,16-17,19-21,24H,5,10-12,15,18H2,1-4H3/b34-30- |
| InChIKey | RDHJTVBPVFUFHM-BVNFUTIRSA-N |
| XLogP | 7.84 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|