C26H26N2O2 — CID 155166271
[9-ethyl-6-[(E)-N-hydroxy-C-propylcarbonimidoyl]carbazol-3-yl]-(2-methylphenyl)methanone (PubChem CID 155166271) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is [9-ethyl-6-[(E)-N-hydroxy-C-propylcarbonimidoyl]carbazol-3-yl]-(2-methylphenyl)methanone.
| Compound Name | [9-ethyl-6-[(E)-N-hydroxy-C-propylcarbonimidoyl]carbazol-3-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 155166271 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [9-ethyl-6-[(E)-N-hydroxy-C-propylcarbonimidoyl]carbazol-3-yl]-(2-methylphenyl)methanone |
| SMILES | CCC/C(=N\O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C26H26N2O2/c1-4-8-23(27-30)18-11-13-24-21(15-18)22-16-19(12-14-25(22)28(24)5-2)26(29)20-10-7-6-9-17(20)3/h6-7,9-16,30H,4-5,8H2,1-3H3/b27-23+ |
| InChIKey | TUHCXLPCKOHQFC-SLEBQGDGSA-N |
| XLogP | 6.33 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|