C31H34N2O2 — CID 155166254
[6-[C-(2-cyclohexylethyl)-N-hydroxycarbonimidoyl]-9-ethylcarbazol-3-yl]-(2-methylphenyl)methanone (PubChem CID 155166254) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is [6-[C-(2-cyclohexylethyl)-N-hydroxycarbonimidoyl]-9-ethylcarbazol-3-yl]-(2-methylphenyl)methanone.
| Compound Name | [6-[C-(2-cyclohexylethyl)-N-hydroxycarbonimidoyl]-9-ethylcarbazol-3-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 155166254 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [6-[C-(2-cyclohexylethyl)-N-hydroxycarbonimidoyl]-9-ethylcarbazol-3-yl]-(2-methylphenyl)methanone |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(C(CCC3CCCCC3)=NO)ccc21 |
| InChI | InChI=1S/C31H34N2O2/c1-3-33-29-17-14-23(28(32-35)16-13-22-10-5-4-6-11-22)19-26(29)27-20-24(15-18-30(27)33)31(34)25-12-8-7-9-21(25)2/h7-9,12,14-15,17-20,22,35H,3-6,10-11,13,16H2,1-2H3 |
| InChIKey | MMUJYBKXNUWSAS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|