C37H34N2O4 — CID 141449161
[(E)-[3-cyclopentyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-2-oxopropylidene]amino] benzoate (PubChem CID 141449161) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is [(E)-[3-cyclopentyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-2-oxopropylidene]amino] benzoate.
| Compound Name | [(E)-[3-cyclopentyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-2-oxopropylidene]amino] benzoate |
|---|---|
| PubChem CID | 141449161 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | [(E)-[3-cyclopentyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-2-oxopropylidene]amino] benzoate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(=N\OC(=O)c3ccccc3)C(=O)CC3CCCC3)ccc21 |
| InChI | InChI=1S/C37H34N2O4/c1-3-39-32-19-17-27(22-30(32)31-23-28(18-20-33(31)39)36(41)29-16-10-7-11-24(29)2)35(34(40)21-25-12-8-9-13-25)38-43-37(42)26-14-5-4-6-15-26/h4-7,10-11,14-20,22-23,25H,3,8-9,12-13,21H2,1-2H3/b38-35+ |
| InChIKey | VPOAJCSPPLETTG-OBEQGSJMSA-N |
| XLogP | 8.06 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|