C36H32N2O4 — CID 118902031
[(E)-[4-cyclopropyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] benzoate (PubChem CID 118902031) has the molecular formula C36H32N2O4 and a molecular weight of 556.66 g/mol. Its IUPAC name is [(E)-[4-cyclopropyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] benzoate.
| Compound Name | [(E)-[4-cyclopropyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 118902031 |
| Molecular Formula | C36H32N2O4 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [(E)-[4-cyclopropyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobutan-2-ylidene]amino] benzoate |
| SMILES | CCn1c2ccc(C(=O)/C(CCC3CC3)=N/OC(=O)c3ccccc3)cc2c2cc(C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C36H32N2O4/c1-3-38-32-19-16-26(34(39)28-12-8-7-9-23(28)2)21-29(32)30-22-27(17-20-33(30)38)35(40)31(18-15-24-13-14-24)37-42-36(41)25-10-5-4-6-11-25/h4-12,16-17,19-22,24H,3,13-15,18H2,1-2H3/b37-31+ |
| InChIKey | GNJNQCZYXXZUFZ-USLOJTSYSA-N |
| XLogP | 7.94 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|