C36H41N3O4 — CID 88591610
[(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-pyrrolidin-1-ylpropanoate (PubChem CID 88591610) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-pyrrolidin-1-ylpropanoate.
| Compound Name | [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-pyrrolidin-1-ylpropanoate |
|---|---|
| PubChem CID | 88591610 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxohexan-2-ylidene]amino] 2-methyl-2-pyrrolidin-1-ylpropanoate |
| SMILES | CCCC/C(=N\OC(=O)C(C)(C)N1CCCC1)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C36H41N3O4/c1-6-8-15-30(37-43-35(42)36(4,5)38-20-11-12-21-38)34(41)26-17-19-32-29(23-26)28-22-25(16-18-31(28)39(32)7-2)33(40)27-14-10-9-13-24(27)3/h9-10,13-14,16-19,22-23H,6-8,11-12,15,20-21H2,1-5H3/b37-30+ |
| InChIKey | JNPYTYWKEWLORQ-GGFUHWEBSA-N |
| XLogP | 7.50 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|