C33H39N3O2 — CID 146507113
[(E)-1-[9-ethyl-6-[(2-methylphenyl)methyl]carbazol-3-yl]ethylideneamino] 2-methyl-2-piperidin-1-ylpropanoate (PubChem CID 146507113) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is [(E)-1-[9-ethyl-6-[(2-methylphenyl)methyl]carbazol-3-yl]ethylideneamino] 2-methyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(E)-1-[9-ethyl-6-[(2-methylphenyl)methyl]carbazol-3-yl]ethylideneamino] 2-methyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 146507113 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [(E)-1-[9-ethyl-6-[(2-methylphenyl)methyl]carbazol-3-yl]ethylideneamino] 2-methyl-2-piperidin-1-ylpropanoate |
| SMILES | CCn1c2ccc(Cc3ccccc3C)cc2c2cc(/C(C)=N/OC(=O)C(C)(C)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C33H39N3O2/c1-6-36-30-16-14-25(20-26-13-9-8-12-23(26)2)21-28(30)29-22-27(15-17-31(29)36)24(3)34-38-32(37)33(4,5)35-18-10-7-11-19-35/h8-9,12-17,21-22H,6-7,10-11,18-20H2,1-5H3/b34-24+ |
| InChIKey | CXHAJZBSYUDVSF-JGRMKTMXSA-N |
| XLogP | 7.25 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|