C40H41N3O6 — CID 88591688
[4-[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino]oxy-3-methyl-3-morpholin-4-yl-4-oxobutyl] benzoate (PubChem CID 88591688) has the molecular formula C40H41N3O6 and a molecular weight of 659.78 g/mol. Its IUPAC name is [4-[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino]oxy-3-methyl-3-morpholin-4-yl-4-oxobutyl] benzoate.
| Compound Name | [4-[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino]oxy-3-methyl-3-morpholin-4-yl-4-oxobutyl] benzoate |
|---|---|
| PubChem CID | 88591688 |
| Molecular Formula | C40H41N3O6 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | [4-[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino]oxy-3-methyl-3-morpholin-4-yl-4-oxobutyl] benzoate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(C)=N/OC(=O)C(C)(CCOC(=O)c3ccccc3)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C40H41N3O6/c1-5-43-35-17-15-30(25-33(35)34-26-31(16-18-36(34)43)37(44)32-14-10-9-11-27(32)2)28(3)41-49-39(46)40(4,42-20-23-47-24-21-42)19-22-48-38(45)29-12-7-6-8-13-29/h6-18,25-26H,5,19-24H2,1-4H3/b41-28+ |
| InChIKey | WPRRKFLJYPDVLG-SISPBFPDSA-N |
| XLogP | 6.96 |
| TPSA | 99.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|