C30H36N2O3 — CID 144561442
ethane;[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] acetate (PubChem CID 144561442) has the molecular formula C30H36N2O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is ethane;[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] acetate.
| Compound Name | ethane;[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 144561442 |
| Molecular Formula | C30H36N2O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | ethane;[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]ethylideneamino] acetate |
| SMILES | CC.CC.CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(C)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C26H24N2O3.2C2H6/c1-5-28-24-12-10-19(17(3)27-31-18(4)29)14-22(24)23-15-20(11-13-25(23)28)26(30)21-9-7-6-8-16(21)2;2*1-2/h6-15H,5H2,1-4H3;2*1-2H3/b27-17+;; |
| InChIKey | JDEHRTNQTAJPIR-HERDGWDJSA-N |
| XLogP | 7.69 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|