C35H30N2O3 — CID 58122005
[(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-5-phenylpent-4-ynylidene]amino] acetate (PubChem CID 58122005) has the molecular formula C35H30N2O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-5-phenylpent-4-ynylidene]amino] acetate.
| Compound Name | [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-5-phenylpent-4-ynylidene]amino] acetate |
|---|---|
| PubChem CID | 58122005 |
| Molecular Formula | C35H30N2O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [(E)-[1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-5-phenylpent-4-ynylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(CCC#Cc3ccccc3)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C35H30N2O3/c1-4-37-33-20-18-27(32(36-40-25(3)38)17-11-9-15-26-13-6-5-7-14-26)22-30(33)31-23-28(19-21-34(31)37)35(39)29-16-10-8-12-24(29)2/h5-8,10,12-14,16,18-23H,4,11,17H2,1-3H3/b36-32+ |
| InChIKey | JOIPMTKOHLJFRN-WIKZRCHHSA-N |
| XLogP | 7.45 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|