C33H38N2O3 — CID 123957224
[1-(6-benzoyl-9-ethylcarbazol-3-yl)decylideneamino] acetate (PubChem CID 123957224) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is [1-(6-benzoyl-9-ethylcarbazol-3-yl)decylideneamino] acetate.
| Compound Name | [1-(6-benzoyl-9-ethylcarbazol-3-yl)decylideneamino] acetate |
|---|---|
| PubChem CID | 123957224 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | [1-(6-benzoyl-9-ethylcarbazol-3-yl)decylideneamino] acetate |
| SMILES | CCCCCCCCCC(=NOC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3)ccc1n2CC |
| InChI | InChI=1S/C33H38N2O3/c1-4-6-7-8-9-10-14-17-30(34-38-24(3)36)26-18-20-31-28(22-26)29-23-27(19-21-32(29)35(31)5-2)33(37)25-15-12-11-13-16-25/h11-13,15-16,18-23H,4-10,14,17H2,1-3H3 |
| InChIKey | ZIEXFNLRZRYTOA-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|