C36H34N2O6S — CID 156846309
[4-[6-[(2E)-2-acetyloxyiminooctanoyl]-9-ethylcarbazole-3-carbonyl]phenyl] thiophene-2-carboxylate (PubChem CID 156846309) has the molecular formula C36H34N2O6S and a molecular weight of 622.74 g/mol. Its IUPAC name is [4-[6-[(2E)-2-acetyloxyiminooctanoyl]-9-ethylcarbazole-3-carbonyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[6-[(2E)-2-acetyloxyiminooctanoyl]-9-ethylcarbazole-3-carbonyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 156846309 |
| Molecular Formula | C36H34N2O6S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | [4-[6-[(2E)-2-acetyloxyiminooctanoyl]-9-ethylcarbazole-3-carbonyl]phenyl] thiophene-2-carboxylate |
| SMILES | CCCCCC/C(=N\OC(C)=O)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(OC(=O)c4cccs4)cc3)ccc1n2CC |
| InChI | InChI=1S/C36H34N2O6S/c1-4-6-7-8-10-30(37-44-23(3)39)35(41)26-15-19-32-29(22-26)28-21-25(14-18-31(28)38(32)5-2)34(40)24-12-16-27(17-13-24)43-36(42)33-11-9-20-45-33/h9,11-22H,4-8,10H2,1-3H3/b37-30+ |
| InChIKey | RESAZOKARXRSEZ-GGFUHWEBSA-N |
| XLogP | 8.40 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|