C35H40N2O5 — CID 168727814
[4-[9-ethyl-6-[(2E)-2-hydroxyiminoheptanoyl]carbazole-3-carbonyl]phenyl] heptanoate (PubChem CID 168727814) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is [4-[9-ethyl-6-[(2E)-2-hydroxyiminoheptanoyl]carbazole-3-carbonyl]phenyl] heptanoate.
| Compound Name | [4-[9-ethyl-6-[(2E)-2-hydroxyiminoheptanoyl]carbazole-3-carbonyl]phenyl] heptanoate |
|---|---|
| PubChem CID | 168727814 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | [4-[9-ethyl-6-[(2E)-2-hydroxyiminoheptanoyl]carbazole-3-carbonyl]phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1ccc(C(=O)c2ccc3c(c2)c2cc(C(=O)/C(CCCCC)=N/O)ccc2n3CC)cc1 |
| InChI | InChI=1S/C35H40N2O5/c1-4-7-9-11-13-33(38)42-27-18-14-24(15-19-27)34(39)25-16-20-31-28(22-25)29-23-26(17-21-32(29)37(31)6-3)35(40)30(36-41)12-10-8-5-2/h14-23,41H,4-13H2,1-3H3/b36-30+ |
| InChIKey | VNVZECOQDBLAKE-FMIFUCRQSA-N |
| XLogP | 8.51 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|