C33H30N2O4 — CID 168727824
(2E)-1-[6-(4-hydroxybenzoyl)-9-phenylcarbazol-3-yl]-2-hydroxyiminooctan-1-one (PubChem CID 168727824) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is (2E)-1-[6-(4-hydroxybenzoyl)-9-phenylcarbazol-3-yl]-2-hydroxyiminooctan-1-one.
| Compound Name | (2E)-1-[6-(4-hydroxybenzoyl)-9-phenylcarbazol-3-yl]-2-hydroxyiminooctan-1-one |
|---|---|
| PubChem CID | 168727824 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (2E)-1-[6-(4-hydroxybenzoyl)-9-phenylcarbazol-3-yl]-2-hydroxyiminooctan-1-one |
| SMILES | CCCCCC/C(=N\O)C(=O)c1ccc2c(c1)c1cc(C(=O)c3ccc(O)cc3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C33H30N2O4/c1-2-3-4-8-11-29(34-39)33(38)24-15-19-31-28(21-24)27-20-23(32(37)22-12-16-26(36)17-13-22)14-18-30(27)35(31)25-9-6-5-7-10-25/h5-7,9-10,12-21,36,39H,2-4,8,11H2,1H3/b34-29+ |
| InChIKey | AGFYTFDVTVMCAN-RIHQVDFKSA-N |
| XLogP | 7.70 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|