About butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium
butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium (PubChem CID 59487979) has the molecular formula C17H20O3Ti
and a molecular weight of 320.21 g/mol. Its IUPAC name is butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium.
Molecular Properties
| Compound Name | butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium |
| PubChem CID | 59487979 |
| Molecular Formula | C17H20O3Ti |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium |
| SMILES | CCCCO.O=C(c1ccccc1)c1ccc(O)cc1.[Ti] |
| InChI | InChI=1S/C13H10O2.C4H10O.Ti/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-2-3-4-5;/h1-9,14H;5H,2-4H2,1H3; |
| InChIKey | NEEQKFIAYHOQFZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium?
The IUPAC name of butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium (CID 59487979) is butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium.
What is the SMILES notation for butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium?
The canonical SMILES for butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium is CCCCO.O=C(c1ccccc1)c1ccc(O)cc1.[Ti].
What is the InChIKey of butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium?
The InChIKey is NEEQKFIAYHOQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.C4H10O.Ti/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-2-3-4-5;/h1-9,14H;5H,2-4H2,1H3;.
What are the key properties of butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium?
butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium has a molecular weight of 320.21 g/mol, XLogP of 3.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;(4-hydroxyphenyl)-phenylmethanone;titanium is sourced from PubChem (CID 59487979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).