About diphenylmethanone;propan-1-amine
diphenylmethanone;propan-1-amine (PubChem CID 174497329) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is diphenylmethanone;propan-1-amine.
Molecular Properties
| Compound Name | diphenylmethanone;propan-1-amine |
| PubChem CID | 174497329 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | diphenylmethanone;propan-1-amine |
| SMILES | CCCN.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C3H9N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4/h1-10H;2-4H2,1H3 |
| InChIKey | WJKPXGCDUSEQHK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenylmethanone;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;propan-1-amine?
The IUPAC name of diphenylmethanone;propan-1-amine (CID 174497329) is diphenylmethanone;propan-1-amine.
What is the SMILES notation for diphenylmethanone;propan-1-amine?
The canonical SMILES for diphenylmethanone;propan-1-amine is CCCN.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;propan-1-amine?
The InChIKey is WJKPXGCDUSEQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C3H9N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4/h1-10H;2-4H2,1H3.
What are the key properties of diphenylmethanone;propan-1-amine?
diphenylmethanone;propan-1-amine has a molecular weight of 241.33 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;propan-1-amine is sourced from PubChem (CID 174497329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).