About benzene-1,4-diol;benzoic acid
benzene-1,4-diol;benzoic acid (PubChem CID 67019242) has the molecular formula C13H12O4
and a molecular weight of 232.24 g/mol. Its IUPAC name is benzene-1,4-diol;benzoic acid.
Molecular Properties
| Compound Name | benzene-1,4-diol;benzoic acid |
| PubChem CID | 67019242 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | benzene-1,4-diol;benzoic acid |
| SMILES | O=C(O)c1ccccc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2.C6H6O2/c8-7(9)6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h1-5H,(H,8,9);1-4,7-8H |
| InChIKey | IGWLHPLQBMPWMO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;benzoic acid?
The IUPAC name of benzene-1,4-diol;benzoic acid (CID 67019242) is benzene-1,4-diol;benzoic acid.
What is the SMILES notation for benzene-1,4-diol;benzoic acid?
The canonical SMILES for benzene-1,4-diol;benzoic acid is O=C(O)c1ccccc1.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;benzoic acid?
The InChIKey is IGWLHPLQBMPWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H6O2/c8-7(9)6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h1-5H,(H,8,9);1-4,7-8H.
What are the key properties of benzene-1,4-diol;benzoic acid?
benzene-1,4-diol;benzoic acid has a molecular weight of 232.24 g/mol, XLogP of 2.48, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;benzoic acid is sourced from PubChem (CID 67019242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).