About 4-hydroxy(11C)benzoic acid
4-hydroxy(11C)benzoic acid (PubChem CID 11275035) has the molecular formula C7H6O3
and a molecular weight of 137.12 g/mol. Its IUPAC name is 4-hydroxy(11C)benzoic acid.
Molecular Properties
| Compound Name | 4-hydroxy(11C)benzoic acid |
| PubChem CID | 11275035 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 137.12 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | 4-hydroxy(11C)benzoic acid |
| SMILES | O=[11C](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)/i7-1 |
| InChIKey | FJKROLUGYXJWQN-JZRMKITLSA-N |
| XLogP | 1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy(11C)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy(11C)benzoic acid?
The IUPAC name of 4-hydroxy(11C)benzoic acid (CID 11275035) is 4-hydroxy(11C)benzoic acid.
What is the SMILES notation for 4-hydroxy(11C)benzoic acid?
The canonical SMILES for 4-hydroxy(11C)benzoic acid is O=[11C](O)c1ccc(O)cc1.
What is the InChIKey of 4-hydroxy(11C)benzoic acid?
The InChIKey is FJKROLUGYXJWQN-JZRMKITLSA-N. The full InChI is InChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)/i7-1.
What are the key properties of 4-hydroxy(11C)benzoic acid?
4-hydroxy(11C)benzoic acid has a molecular weight of 137.12 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy(11C)benzoic acid is sourced from PubChem (CID 11275035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).