About formaldehyde;4-hydroxybenzoic acid
formaldehyde;4-hydroxybenzoic acid (PubChem CID 68624082) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is formaldehyde;4-hydroxybenzoic acid.
Molecular Properties
| Compound Name | formaldehyde;4-hydroxybenzoic acid |
| PubChem CID | 68624082 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | formaldehyde;4-hydroxybenzoic acid |
| SMILES | C=O.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O3.CH2O/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4,8H,(H,9,10);1H2 |
| InChIKey | LKRSCNTVLMFZFK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;4-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4-hydroxybenzoic acid?
The IUPAC name of formaldehyde;4-hydroxybenzoic acid (CID 68624082) is formaldehyde;4-hydroxybenzoic acid.
What is the SMILES notation for formaldehyde;4-hydroxybenzoic acid?
The canonical SMILES for formaldehyde;4-hydroxybenzoic acid is C=O.O=C(O)c1ccc(O)cc1.
What is the InChIKey of formaldehyde;4-hydroxybenzoic acid?
The InChIKey is LKRSCNTVLMFZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.CH2O/c8-6-3-1-5(2-4-6)7(9)10;1-2/h1-4,8H,(H,9,10);1H2.
What are the key properties of formaldehyde;4-hydroxybenzoic acid?
formaldehyde;4-hydroxybenzoic acid has a molecular weight of 168.15 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4-hydroxybenzoic acid is sourced from PubChem (CID 68624082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).