About acetamide;4-hydroxybenzoic acid
acetamide;4-hydroxybenzoic acid (PubChem CID 67150268) has the molecular formula C11H16N2O5
and a molecular weight of 256.26 g/mol. Its IUPAC name is acetamide;4-hydroxybenzoic acid.
Molecular Properties
| Compound Name | acetamide;4-hydroxybenzoic acid |
| PubChem CID | 67150268 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | acetamide;4-hydroxybenzoic acid |
| SMILES | CC(N)=O.CC(N)=O.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O3.2C2H5NO/c8-6-3-1-5(2-4-6)7(9)10;2*1-2(3)4/h1-4,8H,(H,9,10);2*1H3,(H2,3,4) |
| InChIKey | IWSFBBMMNGPHEU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetamide;4-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;4-hydroxybenzoic acid?
The IUPAC name of acetamide;4-hydroxybenzoic acid (CID 67150268) is acetamide;4-hydroxybenzoic acid.
What is the SMILES notation for acetamide;4-hydroxybenzoic acid?
The canonical SMILES for acetamide;4-hydroxybenzoic acid is CC(N)=O.CC(N)=O.O=C(O)c1ccc(O)cc1.
What is the InChIKey of acetamide;4-hydroxybenzoic acid?
The InChIKey is IWSFBBMMNGPHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.2C2H5NO/c8-6-3-1-5(2-4-6)7(9)10;2*1-2(3)4/h1-4,8H,(H,9,10);2*1H3,(H2,3,4).
What are the key properties of acetamide;4-hydroxybenzoic acid?
acetamide;4-hydroxybenzoic acid has a molecular weight of 256.26 g/mol, XLogP of 0.07, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;4-hydroxybenzoic acid is sourced from PubChem (CID 67150268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).