About Sodium;4-hydroxybenzoic acid;hydroxide
Sodium;4-hydroxybenzoic acid;hydroxide (PubChem CID 161288203) has the molecular formula C7H7NaO4
and a molecular weight of 178.12 g/mol. Its IUPAC name is sodium;4-hydroxybenzoic acid;hydroxide.
Molecular Properties
| Compound Name | Sodium;4-hydroxybenzoic acid;hydroxide |
| PubChem CID | 161288203 |
| Molecular Formula | C7H7NaO4 |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | sodium;4-hydroxybenzoic acid;hydroxide |
| SMILES | C1=CC(=CC=C1C(=O)O)O.[OH-].[Na+] |
| InChI | InChI=1S/C7H6O3.Na.H2O/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4,8H,(H,9,10);;1H2/q;+1;/p-1 |
| InChIKey | VFZPYWIVLPCWMW-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 58.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 127 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Sodium;4-hydroxybenzoic acid;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium;4-hydroxybenzoic acid;hydroxide?
The IUPAC name of Sodium;4-hydroxybenzoic acid;hydroxide (CID 161288203) is sodium;4-hydroxybenzoic acid;hydroxide.
What is the SMILES notation for Sodium;4-hydroxybenzoic acid;hydroxide?
The canonical SMILES for Sodium;4-hydroxybenzoic acid;hydroxide is C1=CC(=CC=C1C(=O)O)O.[OH-].[Na+].
What is the InChIKey of Sodium;4-hydroxybenzoic acid;hydroxide?
The InChIKey is VFZPYWIVLPCWMW-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.Na.H2O/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4,8H,(H,9,10);;1H2/q;+1;/p-1.
What are the key properties of Sodium;4-hydroxybenzoic acid;hydroxide?
Sodium;4-hydroxybenzoic acid;hydroxide has a molecular weight of 178.12 g/mol, XLogP of not available, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium;4-hydroxybenzoic acid;hydroxide is sourced from PubChem (CID 161288203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).