About sodium;acetic acid;4-hydroxybenzoic acid;acetate
sodium;acetic acid;4-hydroxybenzoic acid;acetate (PubChem CID 175708691) has the molecular formula C11H13NaO7
and a molecular weight of 280.21 g/mol. Its IUPAC name is sodium;acetic acid;4-hydroxybenzoic acid;acetate.
Molecular Properties
| Compound Name | sodium;acetic acid;4-hydroxybenzoic acid;acetate |
| PubChem CID | 175708691 |
| Molecular Formula | C11H13NaO7 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | sodium;acetic acid;4-hydroxybenzoic acid;acetate |
| SMILES | CC(=O)O.CC(=O)[O-].O=C(O)c1ccc(O)cc1.[Na+] |
| InChI | InChI=1S/C7H6O3.2C2H4O2.Na/c8-6-3-1-5(2-4-6)7(9)10;2*1-2(3)4;/h1-4,8H,(H,9,10);2*1H3,(H,3,4);/q;;;+1/p-1 |
| InChIKey | CYCBDAGZNQFWHS-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium;acetic acid;4-hydroxybenzoic acid;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;4-hydroxybenzoic acid;acetate?
The IUPAC name of sodium;acetic acid;4-hydroxybenzoic acid;acetate (CID 175708691) is sodium;acetic acid;4-hydroxybenzoic acid;acetate.
What is the SMILES notation for sodium;acetic acid;4-hydroxybenzoic acid;acetate?
The canonical SMILES for sodium;acetic acid;4-hydroxybenzoic acid;acetate is CC(=O)O.CC(=O)[O-].O=C(O)c1ccc(O)cc1.[Na+].
What is the InChIKey of sodium;acetic acid;4-hydroxybenzoic acid;acetate?
The InChIKey is CYCBDAGZNQFWHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.2C2H4O2.Na/c8-6-3-1-5(2-4-6)7(9)10;2*1-2(3)4;/h1-4,8H,(H,9,10);2*1H3,(H,3,4);/q;;;+1/p-1.
What are the key properties of sodium;acetic acid;4-hydroxybenzoic acid;acetate?
sodium;acetic acid;4-hydroxybenzoic acid;acetate has a molecular weight of 280.21 g/mol, XLogP of -3.06, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;4-hydroxybenzoic acid;acetate is sourced from PubChem (CID 175708691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).