About benzoic acid;hexan-1-ol
benzoic acid;hexan-1-ol (PubChem CID 175334621) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is benzoic acid;hexan-1-ol.
Molecular Properties
| Compound Name | benzoic acid;hexan-1-ol |
| PubChem CID | 175334621 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | benzoic acid;hexan-1-ol |
| SMILES | CCCCCCO.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H14O/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6-7/h1-5H,(H,8,9);7H,2-6H2,1H3 |
| InChIKey | VXEWQMUEXJKPAV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;hexan-1-ol?
The IUPAC name of benzoic acid;hexan-1-ol (CID 175334621) is benzoic acid;hexan-1-ol.
What is the SMILES notation for benzoic acid;hexan-1-ol?
The canonical SMILES for benzoic acid;hexan-1-ol is CCCCCCO.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;hexan-1-ol?
The InChIKey is VXEWQMUEXJKPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H14O/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6-7/h1-5H,(H,8,9);7H,2-6H2,1H3.
What are the key properties of benzoic acid;hexan-1-ol?
benzoic acid;hexan-1-ol has a molecular weight of 224.30 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;hexan-1-ol is sourced from PubChem (CID 175334621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).