About sodium;benzoic acid;octan-1-one
sodium;benzoic acid;octan-1-one (PubChem CID 174690218) has the molecular formula C15H21NaO3
and a molecular weight of 272.32 g/mol. Its IUPAC name is sodium;benzoic acid;octan-1-one.
Molecular Properties
| Compound Name | sodium;benzoic acid;octan-1-one |
| PubChem CID | 174690218 |
| Molecular Formula | C15H21NaO3 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | sodium;benzoic acid;octan-1-one |
| SMILES | CCCCCCC[C-]=O.O=C(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C8H15O.C7H6O2.Na/c1-2-3-4-5-6-7-8-9;8-7(9)6-4-2-1-3-5-6;/h2-7H2,1H3;1-5H,(H,8,9);/q-1;;+1 |
| InChIKey | ZYGJBHHTNVBSKY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzoic acid;octan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzoic acid;octan-1-one?
The IUPAC name of sodium;benzoic acid;octan-1-one (CID 174690218) is sodium;benzoic acid;octan-1-one.
What is the SMILES notation for sodium;benzoic acid;octan-1-one?
The canonical SMILES for sodium;benzoic acid;octan-1-one is CCCCCCC[C-]=O.O=C(O)c1ccccc1.[Na+].
What is the InChIKey of sodium;benzoic acid;octan-1-one?
The InChIKey is ZYGJBHHTNVBSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O.C7H6O2.Na/c1-2-3-4-5-6-7-8-9;8-7(9)6-4-2-1-3-5-6;/h2-7H2,1H3;1-5H,(H,8,9);/q-1;;+1.
What are the key properties of sodium;benzoic acid;octan-1-one?
sodium;benzoic acid;octan-1-one has a molecular weight of 272.32 g/mol, XLogP of 0.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzoic acid;octan-1-one is sourced from PubChem (CID 174690218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).