About benzoic acid;octan-2-one
benzoic acid;octan-2-one (PubChem CID 174815510) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is benzoic acid;octan-2-one.
Molecular Properties
| Compound Name | benzoic acid;octan-2-one |
| PubChem CID | 174815510 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | benzoic acid;octan-2-one |
| SMILES | CCCCCCC(C)=O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H16O.C7H6O2/c1-3-4-5-6-7-8(2)9;8-7(9)6-4-2-1-3-5-6/h3-7H2,1-2H3;1-5H,(H,8,9) |
| InChIKey | DFZDGWSWVWMSRI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;octan-2-one?
The IUPAC name of benzoic acid;octan-2-one (CID 174815510) is benzoic acid;octan-2-one.
What is the SMILES notation for benzoic acid;octan-2-one?
The canonical SMILES for benzoic acid;octan-2-one is CCCCCCC(C)=O.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;octan-2-one?
The InChIKey is DFZDGWSWVWMSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C7H6O2/c1-3-4-5-6-7-8(2)9;8-7(9)6-4-2-1-3-5-6/h3-7H2,1-2H3;1-5H,(H,8,9).
What are the key properties of benzoic acid;octan-2-one?
benzoic acid;octan-2-one has a molecular weight of 250.34 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;octan-2-one is sourced from PubChem (CID 174815510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).