About anisole;hexadecan-2-one
anisole;hexadecan-2-one (PubChem CID 167511071) has the molecular formula C23H40O2
and a molecular weight of 348.57 g/mol. Its IUPAC name is anisole;hexadecan-2-one.
Molecular Properties
| Compound Name | anisole;hexadecan-2-one |
| PubChem CID | 167511071 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | anisole;hexadecan-2-one |
| SMILES | CCCCCCCCCCCCCCC(C)=O.COc1ccccc1 |
| InChI | InChI=1S/C16H32O.C7H8O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17;1-8-7-5-3-2-4-6-7/h3-15H2,1-2H3;2-6H,1H3 |
| InChIKey | YCXREWGIPQKLKK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze anisole;hexadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;hexadecan-2-one?
The IUPAC name of anisole;hexadecan-2-one (CID 167511071) is anisole;hexadecan-2-one.
What is the SMILES notation for anisole;hexadecan-2-one?
The canonical SMILES for anisole;hexadecan-2-one is CCCCCCCCCCCCCCC(C)=O.COc1ccccc1.
What is the InChIKey of anisole;hexadecan-2-one?
The InChIKey is YCXREWGIPQKLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O.C7H8O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17;1-8-7-5-3-2-4-6-7/h3-15H2,1-2H3;2-6H,1H3.
What are the key properties of anisole;hexadecan-2-one?
anisole;hexadecan-2-one has a molecular weight of 348.57 g/mol, XLogP of 7.36, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;hexadecan-2-one is sourced from PubChem (CID 167511071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).