About diphenylmethanone;heptanal;heptan-1-ol
diphenylmethanone;heptanal;heptan-1-ol (PubChem CID 158829151) has the molecular formula C27H40O3
and a molecular weight of 412.61 g/mol. Its IUPAC name is diphenylmethanone;heptanal;heptan-1-ol.
Molecular Properties
| Compound Name | diphenylmethanone;heptanal;heptan-1-ol |
| PubChem CID | 158829151 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | diphenylmethanone;heptanal;heptan-1-ol |
| SMILES | CCCCCCC=O.CCCCCCCO.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C7H16O.C7H14O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2*1-2-3-4-5-6-7-8/h1-10H;8H,2-7H2,1H3;7H,2-6H2,1H3 |
| InChIKey | IWVDJJVRWZQQJR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;heptanal;heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;heptanal;heptan-1-ol?
The IUPAC name of diphenylmethanone;heptanal;heptan-1-ol (CID 158829151) is diphenylmethanone;heptanal;heptan-1-ol.
What is the SMILES notation for diphenylmethanone;heptanal;heptan-1-ol?
The canonical SMILES for diphenylmethanone;heptanal;heptan-1-ol is CCCCCCC=O.CCCCCCCO.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;heptanal;heptan-1-ol?
The InChIKey is IWVDJJVRWZQQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C7H16O.C7H14O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2*1-2-3-4-5-6-7-8/h1-10H;8H,2-7H2,1H3;7H,2-6H2,1H3.
What are the key properties of diphenylmethanone;heptanal;heptan-1-ol?
diphenylmethanone;heptanal;heptan-1-ol has a molecular weight of 412.61 g/mol, XLogP of 7.02, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;heptanal;heptan-1-ol is sourced from PubChem (CID 158829151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).