About hexanal;(2-nitrophenyl)-phenylmethanone
hexanal;(2-nitrophenyl)-phenylmethanone (PubChem CID 174285873) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is hexanal;(2-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | hexanal;(2-nitrophenyl)-phenylmethanone |
| PubChem CID | 174285873 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | hexanal;(2-nitrophenyl)-phenylmethanone |
| SMILES | CCCCCC=O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO3.C6H12O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-3-4-5-6-7/h1-9H;6H,2-5H2,1H3 |
| InChIKey | HQBXYVVHZGTFMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hexanal;(2-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanal;(2-nitrophenyl)-phenylmethanone?
The IUPAC name of hexanal;(2-nitrophenyl)-phenylmethanone (CID 174285873) is hexanal;(2-nitrophenyl)-phenylmethanone.
What is the SMILES notation for hexanal;(2-nitrophenyl)-phenylmethanone?
The canonical SMILES for hexanal;(2-nitrophenyl)-phenylmethanone is CCCCCC=O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of hexanal;(2-nitrophenyl)-phenylmethanone?
The InChIKey is HQBXYVVHZGTFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C6H12O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-3-4-5-6-7/h1-9H;6H,2-5H2,1H3.
What are the key properties of hexanal;(2-nitrophenyl)-phenylmethanone?
hexanal;(2-nitrophenyl)-phenylmethanone has a molecular weight of 327.38 g/mol, XLogP of 4.59, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanal;(2-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 174285873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).