About (2-nitrophenyl)-phenylmethanone;pentanal
(2-nitrophenyl)-phenylmethanone;pentanal (PubChem CID 174293543) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is (2-nitrophenyl)-phenylmethanone;pentanal.
Molecular Properties
| Compound Name | (2-nitrophenyl)-phenylmethanone;pentanal |
| PubChem CID | 174293543 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2-nitrophenyl)-phenylmethanone;pentanal |
| SMILES | CCCCC=O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO3.C5H10O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-3-4-5-6/h1-9H;5H,2-4H2,1H3 |
| InChIKey | IDRHJXAVOHPTKR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)-phenylmethanone;pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)-phenylmethanone;pentanal?
The IUPAC name of (2-nitrophenyl)-phenylmethanone;pentanal (CID 174293543) is (2-nitrophenyl)-phenylmethanone;pentanal.
What is the SMILES notation for (2-nitrophenyl)-phenylmethanone;pentanal?
The canonical SMILES for (2-nitrophenyl)-phenylmethanone;pentanal is CCCCC=O.O=C(c1ccccc1)c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)-phenylmethanone;pentanal?
The InChIKey is IDRHJXAVOHPTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C5H10O/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17;1-2-3-4-5-6/h1-9H;5H,2-4H2,1H3.
What are the key properties of (2-nitrophenyl)-phenylmethanone;pentanal?
(2-nitrophenyl)-phenylmethanone;pentanal has a molecular weight of 313.35 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)-phenylmethanone;pentanal is sourced from PubChem (CID 174293543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).