About decanal;1-phenylethanone
decanal;1-phenylethanone (PubChem CID 161488656) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is decanal;1-phenylethanone.
Molecular Properties
| Compound Name | decanal;1-phenylethanone |
| PubChem CID | 161488656 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | decanal;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CCCCCCCCCC=O |
| InChI | InChI=1S/C10H20O.C8H8O/c1-2-3-4-5-6-7-8-9-10-11;1-7(9)8-5-3-2-4-6-8/h10H,2-9H2,1H3;2-6H,1H3 |
| InChIKey | WFHTXMLMHMQLKE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanal;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanal;1-phenylethanone?
The IUPAC name of decanal;1-phenylethanone (CID 161488656) is decanal;1-phenylethanone.
What is the SMILES notation for decanal;1-phenylethanone?
The canonical SMILES for decanal;1-phenylethanone is CC(=O)c1ccccc1.CCCCCCCCCC=O.
What is the InChIKey of decanal;1-phenylethanone?
The InChIKey is WFHTXMLMHMQLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C8H8O/c1-2-3-4-5-6-7-8-9-10-11;1-7(9)8-5-3-2-4-6-8/h10H,2-9H2,1H3;2-6H,1H3.
What are the key properties of decanal;1-phenylethanone?
decanal;1-phenylethanone has a molecular weight of 276.42 g/mol, XLogP of 5.22, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanal;1-phenylethanone is sourced from PubChem (CID 161488656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).