About N-decylidenebenzamide
N-decylidenebenzamide (PubChem CID 90984528) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is N-decylidenebenzamide.
Molecular Properties
| Compound Name | N-decylidenebenzamide |
| PubChem CID | 90984528 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-decylidenebenzamide |
| SMILES | CCCCCCCCC/C=N/C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-2-3-4-5-6-7-8-12-15-18-17(19)16-13-10-9-11-14-16/h9-11,13-15H,2-8,12H2,1H3/b18-15+ |
| InChIKey | VJASNSKRDZXDKO-OBGWFSINSA-N |
| XLogP | 5.04 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-decylidenebenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decylidenebenzamide?
The IUPAC name of N-decylidenebenzamide (CID 90984528) is N-decylidenebenzamide.
What is the SMILES notation for N-decylidenebenzamide?
The canonical SMILES for N-decylidenebenzamide is CCCCCCCCC/C=N/C(=O)c1ccccc1.
What is the InChIKey of N-decylidenebenzamide?
The InChIKey is VJASNSKRDZXDKO-OBGWFSINSA-N. The full InChI is InChI=1S/C17H25NO/c1-2-3-4-5-6-7-8-12-15-18-17(19)16-13-10-9-11-14-16/h9-11,13-15H,2-8,12H2,1H3/b18-15+.
What are the key properties of N-decylidenebenzamide?
N-decylidenebenzamide has a molecular weight of 259.39 g/mol, XLogP of 5.04, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylidenebenzamide is sourced from PubChem (CID 90984528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).