About 5-phenacylidenenonanal
5-phenacylidenenonanal (PubChem CID 71404073) has the molecular formula C17H22O2
and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-phenacylidenenonanal.
Molecular Properties
| Compound Name | 5-phenacylidenenonanal |
| PubChem CID | 71404073 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 5-phenacylidenenonanal |
| SMILES | CCCCC(=CC(=O)c1ccccc1)CCCC=O |
| InChI | InChI=1S/C17H22O2/c1-2-3-9-15(10-7-8-13-18)14-17(19)16-11-5-4-6-12-16/h4-6,11-14H,2-3,7-10H2,1H3 |
| InChIKey | VXXMHBSCSLXEKI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-phenacylidenenonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenacylidenenonanal?
The IUPAC name of 5-phenacylidenenonanal (CID 71404073) is 5-phenacylidenenonanal.
What is the SMILES notation for 5-phenacylidenenonanal?
The canonical SMILES for 5-phenacylidenenonanal is CCCCC(=CC(=O)c1ccccc1)CCCC=O.
What is the InChIKey of 5-phenacylidenenonanal?
The InChIKey is VXXMHBSCSLXEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O2/c1-2-3-9-15(10-7-8-13-18)14-17(19)16-11-5-4-6-12-16/h4-6,11-14H,2-3,7-10H2,1H3.
What are the key properties of 5-phenacylidenenonanal?
5-phenacylidenenonanal has a molecular weight of 258.36 g/mol, XLogP of 4.36, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenacylidenenonanal is sourced from PubChem (CID 71404073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).