C27H44 — CID 11257173
[(2E,4E)-5-butyl-3-hexylundeca-2,4-dien-2-yl]benzene (PubChem CID 11257173) has the molecular formula C27H44 and a molecular weight of 368.65 g/mol. Its IUPAC name is [(2E,4E)-5-butyl-3-hexylundeca-2,4-dien-2-yl]benzene.
| Compound Name | [(2E,4E)-5-butyl-3-hexylundeca-2,4-dien-2-yl]benzene |
|---|---|
| PubChem CID | 11257173 |
| Molecular Formula | C27H44 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | [(2E,4E)-5-butyl-3-hexylundeca-2,4-dien-2-yl]benzene |
| SMILES | CCCCCC/C(=C/C(CCCCCC)=C(\C)c1ccccc1)CCCC |
| InChI | InChI=1S/C27H44/c1-5-8-11-14-19-25(18-10-7-3)23-27(22-15-12-9-6-2)24(4)26-20-16-13-17-21-26/h13,16-17,20-21,23H,5-12,14-15,18-19,22H2,1-4H3/b25-23+,27-24+ |
| InChIKey | BPJQKXUMPFLZLI-STPBDFRUSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|