C25H41ISi — CID 71417747
(2-hexyl-1-iodo-4-phenyldeca-1,3-dienyl)-trimethylsilane (PubChem CID 71417747) has the molecular formula C25H41ISi and a molecular weight of 496.59 g/mol. Its IUPAC name is (2-hexyl-1-iodo-4-phenyldeca-1,3-dienyl)-trimethylsilane.
| Compound Name | (2-hexyl-1-iodo-4-phenyldeca-1,3-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 71417747 |
| Molecular Formula | C25H41ISi |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (2-hexyl-1-iodo-4-phenyldeca-1,3-dienyl)-trimethylsilane |
| SMILES | CCCCCCC(=CC(CCCCCC)=C(I)[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H41ISi/c1-6-8-10-13-19-23(22-17-15-12-16-18-22)21-24(20-14-11-9-7-2)25(26)27(3,4)5/h12,15-18,21H,6-11,13-14,19-20H2,1-5H3 |
| InChIKey | XAHMHZHUKVZZFC-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|