C26H43IOSi — CID 177406293
(Z,4E)-2-hexyl-4-[iodo(trimethylsilyl)methylidene]-1-phenyldec-2-en-1-ol (PubChem CID 177406293) has the molecular formula C26H43IOSi and a molecular weight of 526.62 g/mol. Its IUPAC name is (Z,4E)-2-hexyl-4-[iodo(trimethylsilyl)methylidene]-1-phenyldec-2-en-1-ol.
| Compound Name | (Z,4E)-2-hexyl-4-[iodo(trimethylsilyl)methylidene]-1-phenyldec-2-en-1-ol |
|---|---|
| PubChem CID | 177406293 |
| Molecular Formula | C26H43IOSi |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (Z,4E)-2-hexyl-4-[iodo(trimethylsilyl)methylidene]-1-phenyldec-2-en-1-ol |
| SMILES | CCCCCC/C(=C/C(CCCCCC)=C(/I)[Si](C)(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C26H43IOSi/c1-6-8-10-13-19-23(25(28)22-17-15-12-16-18-22)21-24(20-14-11-9-7-2)26(27)29(3,4)5/h12,15-18,21,25,28H,6-11,13-14,19-20H2,1-5H3/b23-21-,26-24- |
| InChIKey | HRNOBTFTFKTZAT-NPGCFZLRSA-N |
| XLogP | 9.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|