C16H24O2 — CID 102384202
(1S,2S)-1-hydroxy-2-methyl-1-phenylnonan-3-one (PubChem CID 102384202) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2S)-1-hydroxy-2-methyl-1-phenylnonan-3-one.
| Compound Name | (1S,2S)-1-hydroxy-2-methyl-1-phenylnonan-3-one |
|---|---|
| PubChem CID | 102384202 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2S)-1-hydroxy-2-methyl-1-phenylnonan-3-one |
| SMILES | CCCCCCC(=O)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H24O2/c1-3-4-5-9-12-15(17)13(2)16(18)14-10-7-6-8-11-14/h6-8,10-11,13,16,18H,3-5,9,12H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | WJCVNXKBWMBOOB-CJNGLKHVSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|