C15H21IO2 — CID 101050082
(1R,2R)-1-hydroxy-2-(iodomethyl)-1-phenyloctan-3-one (PubChem CID 101050082) has the molecular formula C15H21IO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is (1R,2R)-1-hydroxy-2-(iodomethyl)-1-phenyloctan-3-one.
| Compound Name | (1R,2R)-1-hydroxy-2-(iodomethyl)-1-phenyloctan-3-one |
|---|---|
| PubChem CID | 101050082 |
| Molecular Formula | C15H21IO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (1R,2R)-1-hydroxy-2-(iodomethyl)-1-phenyloctan-3-one |
| SMILES | CCCCCC(=O)[C@H](CI)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H21IO2/c1-2-3-5-10-14(17)13(11-16)15(18)12-8-6-4-7-9-12/h4,6-9,13,15,18H,2-3,5,10-11H2,1H3/t13-,15-/m0/s1 |
| InChIKey | QBXQAJDEGJQCES-ZFWWWQNUSA-N |
| XLogP | 3.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|