C18H26O2 — CID 10778735
(5R)-5-[(S)-hydroxy(phenyl)methyl]undec-1-en-4-one (PubChem CID 10778735) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (5R)-5-[(S)-hydroxy(phenyl)methyl]undec-1-en-4-one.
| Compound Name | (5R)-5-[(S)-hydroxy(phenyl)methyl]undec-1-en-4-one |
|---|---|
| PubChem CID | 10778735 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (5R)-5-[(S)-hydroxy(phenyl)methyl]undec-1-en-4-one |
| SMILES | C=CCC(=O)[C@H](CCCCCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-3-5-6-10-14-16(17(19)11-4-2)18(20)15-12-8-7-9-13-15/h4,7-9,12-13,16,18,20H,2-3,5-6,10-11,14H2,1H3/t16-,18+/m0/s1 |
| InChIKey | QCDXVBMTFJIKEZ-FUHWJXTLSA-N |
| XLogP | 4.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|