C17H28OSi — CID 10446181
(1S,2R)-1-phenyl-2-(1-trimethylsilylethenyl)hexan-1-ol (PubChem CID 10446181) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (1S,2R)-1-phenyl-2-(1-trimethylsilylethenyl)hexan-1-ol.
| Compound Name | (1S,2R)-1-phenyl-2-(1-trimethylsilylethenyl)hexan-1-ol |
|---|---|
| PubChem CID | 10446181 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (1S,2R)-1-phenyl-2-(1-trimethylsilylethenyl)hexan-1-ol |
| SMILES | C=C([C@H](CCCC)[C@H](O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C17H28OSi/c1-6-7-13-16(14(2)19(3,4)5)17(18)15-11-9-8-10-12-15/h8-12,16-18H,2,6-7,13H2,1,3-5H3/t16-,17+/m0/s1 |
| InChIKey | QVWMDISVXBKJEU-DLBZAZTESA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|