C13H21NO — CID 10774706
(1R,2R)-2-(aminomethyl)-1-phenylhexan-1-ol (PubChem CID 10774706) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1R,2R)-2-(aminomethyl)-1-phenylhexan-1-ol.
| Compound Name | (1R,2R)-2-(aminomethyl)-1-phenylhexan-1-ol |
|---|---|
| PubChem CID | 10774706 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1R,2R)-2-(aminomethyl)-1-phenylhexan-1-ol |
| SMILES | CCCC[C@H](CN)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H21NO/c1-2-3-7-12(10-14)13(15)11-8-5-4-6-9-11/h4-6,8-9,12-13,15H,2-3,7,10,14H2,1H3/t12-,13+/m1/s1 |
| InChIKey | DUKKHRIFLQADPP-OLZOCXBDSA-N |
| XLogP | 2.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |