C12H20N2O — CID 39869601
(1R,2S)-2-(aminomethyl)-3-(dimethylamino)-1-phenylpropan-1-ol (PubChem CID 39869601) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (1R,2S)-2-(aminomethyl)-3-(dimethylamino)-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(aminomethyl)-3-(dimethylamino)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 39869601 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (1R,2S)-2-(aminomethyl)-3-(dimethylamino)-1-phenylpropan-1-ol |
| SMILES | CN(C)C[C@H](CN)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H20N2O/c1-14(2)9-11(8-13)12(15)10-6-4-3-5-7-10/h3-7,11-12,15H,8-9,13H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CJOOTINYVCEDFO-RYUDHWBXSA-N |
| XLogP | 0.86 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |