C11H17N — CID 59474206
(2R)-N,N-dimethyl-2-phenylpropan-1-amine (PubChem CID 59474206) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-phenylpropan-1-amine.
| Compound Name | (2R)-N,N-dimethyl-2-phenylpropan-1-amine |
|---|---|
| PubChem CID | 59474206 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2R)-N,N-dimethyl-2-phenylpropan-1-amine |
| SMILES | C[C@@H](CN(C)C)c1ccccc1 |
| InChI | InChI=1S/C11H17N/c1-10(9-12(2)3)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | JFNWQFWYAAPODB-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |