C12H20N2 — CID 62618546
N',N',2-trimethyl-1-phenylpropane-1,3-diamine (PubChem CID 62618546) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N',N',2-trimethyl-1-phenylpropane-1,3-diamine.
| Compound Name | N',N',2-trimethyl-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62618546 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N',N',2-trimethyl-1-phenylpropane-1,3-diamine |
| SMILES | CC(CN(C)C)C(N)c1ccccc1 |
| InChI | InChI=1S/C12H20N2/c1-10(9-14(2)3)12(13)11-7-5-4-6-8-11/h4-8,10,12H,9,13H2,1-3H3 |
| InChIKey | YSAZLRHMUWIYBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |