C16H24N2 — CID 62619076
2-methyl-1-phenyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine (PubChem CID 62619076) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-methyl-1-phenyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine.
| Compound Name | 2-methyl-1-phenyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62619076 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-methyl-1-phenyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
| SMILES | C=CCN(CC=C)CC(C)C(N)c1ccccc1 |
| InChI | InChI=1S/C16H24N2/c1-4-11-18(12-5-2)13-14(3)16(17)15-9-7-6-8-10-15/h4-10,14,16H,1-2,11-13,17H2,3H3 |
| InChIKey | MWVHHLQDIZCYHZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|