C15H22N2 — CID 102380041
(2S)-2-N-phenyl-1-N,1-N-bis(prop-2-enyl)propane-1,2-diamine (PubChem CID 102380041) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (2S)-2-N-phenyl-1-N,1-N-bis(prop-2-enyl)propane-1,2-diamine.
| Compound Name | (2S)-2-N-phenyl-1-N,1-N-bis(prop-2-enyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 102380041 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2S)-2-N-phenyl-1-N,1-N-bis(prop-2-enyl)propane-1,2-diamine |
| SMILES | C=CCN(CC=C)C[C@H](C)Nc1ccccc1 |
| InChI | InChI=1S/C15H22N2/c1-4-11-17(12-5-2)13-14(3)16-15-9-7-6-8-10-15/h4-10,14,16H,1-2,11-13H2,3H3/t14-/m0/s1 |
| InChIKey | OIOHRQIPKYOJNB-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|