C11H18N2 — CID 156531414
4-N-phenylpentane-2,4-diamine (PubChem CID 156531414) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-N-phenylpentane-2,4-diamine.
| Compound Name | 4-N-phenylpentane-2,4-diamine |
|---|---|
| PubChem CID | 156531414 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-N-phenylpentane-2,4-diamine |
| SMILES | CC(N)CC(C)Nc1ccccc1 |
| InChI | InChI=1S/C11H18N2/c1-9(12)8-10(2)13-11-6-4-3-5-7-11/h3-7,9-10,13H,8,12H2,1-2H3 |
| InChIKey | BVYGCOLNKLVJQR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |