C14H24N2 — CID 13185865
2-N,2-N,2-trimethyl-4-N-phenylpentane-2,4-diamine (PubChem CID 13185865) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-N,2-N,2-trimethyl-4-N-phenylpentane-2,4-diamine.
| Compound Name | 2-N,2-N,2-trimethyl-4-N-phenylpentane-2,4-diamine |
|---|---|
| PubChem CID | 13185865 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-N,2-N,2-trimethyl-4-N-phenylpentane-2,4-diamine |
| SMILES | CC(CC(C)(C)N(C)C)Nc1ccccc1 |
| InChI | InChI=1S/C14H24N2/c1-12(11-14(2,3)16(4)5)15-13-9-7-6-8-10-13/h6-10,12,15H,11H2,1-5H3 |
| InChIKey | JSOYOVHMBRTPJB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |