C16H26N2 — CID 62618384
N'-cyclopentyl-N',2-dimethyl-1-phenylpropane-1,3-diamine (PubChem CID 62618384) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-cyclopentyl-N',2-dimethyl-1-phenylpropane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N',2-dimethyl-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62618384 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-cyclopentyl-N',2-dimethyl-1-phenylpropane-1,3-diamine |
| SMILES | CC(CN(C)C1CCCC1)C(N)c1ccccc1 |
| InChI | InChI=1S/C16H26N2/c1-13(12-18(2)15-10-6-7-11-15)16(17)14-8-4-3-5-9-14/h3-5,8-9,13,15-16H,6-7,10-12,17H2,1-2H3 |
| InChIKey | GGSVGLHGFWMDHK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |